15892-23-6 (+/-)-2-butanol
termék neve |
(+/-)-2-butanol |
Angol név |
(+/-)-2-butanol; (±)-2-Butanol; .+/-.-2-Butanol; 15892-23-6; DL-Butan-2-ol; DL-METHYLETHYLCARBINOL; dl-sec-Butanol; methyl-2-propanol; butan-2-ol |
MF |
C4H10O |
Molekulatömeg |
74.1216 |
InChI |
InChI=1/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3 |
CAS-szám |
15892-23-6 |
EINECS |
240-029-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.801g/cm3 |
Forráspont |
96.6°C at 760 mmHg |
Törésmutató |
1.393 |
Gyulladáspont |
26.7°C |
Gőznyomás |
25.2mmHg at 25°C |
Kockázatot kódok |
R10:Flammable.;
R36/37:Irritating to eyes and respiratory system.;
|
Biztonsági Leírás |
S13:Keep away from food, drink and animal feeding stuffs.;
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S46:If swallowed, seek medical advice immediately and show this container or label.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|