16000-39-8 2-metoxi-1-naftonitril
termék neve |
2-metoxi-1-naftonitril |
Szinonimák |
; 1-ciano-2-metoxinaftalin; 2-metoxinaftalin-1-karbonitril |
Angol név |
2-Methoxy-1-naphthonitrile; 1-Cyano-2-methoxynaphtalene; 2-methoxynaphthalene-1-carbonitrile |
MF |
C12H9NO |
Molekulatömeg |
183.206 |
InChI |
InChI=1/C12H9NO/c1-14-12-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-7H,1H3 |
CAS-szám |
16000-39-8 |
EINECS |
240-133-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.16g/cm3 |
Olvadáspont |
94-96℃ |
Forráspont |
362.8°C at 760 mmHg |
Törésmutató |
1.622 |
Gyulladáspont |
153°C |
Gőznyomás |
1.89E-05mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21:Harmful by inhalation and in contact with skin.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|