1631-83-0 Diphenylchlorosilane

termék neve	Diphenylchlorosilane
Angol név	Diphenylchlorosilane; Chlorodiphenylsilane; chloro(diphenyl)silyl
MF	C₁₂H₁₀ClSi
Molekulatömeg	217.7463
InChI	InChI=1/C12H10ClSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
CAS-szám	1631-83-0
EINECS	216-634-8
Molekuláris szerkezete
Veszély szimbólumok
Kockázatot kódok	R34:Causes burns.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;