ChemNet > CAS > 16382-15-3 Ethyl 5-methylindole-2-carboxylate
16382-15-3 Ethyl 5-methylindole-2-carboxylate
termék neve |
Ethyl 5-methylindole-2-carboxylate |
Angol név |
Ethyl 5-methylindole-2-carboxylate; 5-Methylindole-2-carboxylic acid ethyl ester; ethyl 5-methyl-1H-indole-2-carboxylate |
MF |
C12H13NO2 |
Molekulatömeg |
203.2371 |
InChI |
InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
CAS-szám |
16382-15-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.177g/cm3 |
Forráspont |
356.5°C at 760 mmHg |
Törésmutató |
1.609 |
Gyulladáspont |
169.4°C |
Gőznyomás |
2.9E-05mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|