ChemNet > CAS > 16620-52-3 5-Methoxygramine
16620-52-3 5-Methoxygramine
| termék neve |
5-Methoxygramine |
| Angol név |
5-Methoxygramine; 2-dimethylaminomethyl-5-methoxyindole; N-[(5-Methoxy-1H-indol-3-yl)methyl]-N,N-dimethylamine; 1-(5-methoxy-1H-indol-3-yl)-N,N-dimethylmethanamine; (5-methoxy-1H-indol-3-yl)-N,N-dimethylmethanaminium |
| MF |
C12H17N2O |
| Molekulatömeg |
205.2756 |
| InChI |
InChI=1/C12H16N2O/c1-14(2)8-9-7-13-12-5-4-10(15-3)6-11(9)12/h4-7,13H,8H2,1-3H3/p+1 |
| CAS-szám |
16620-52-3 |
| EINECS |
240-669-8 |
| Molekuláris szerkezete |
|
| Olvadáspont |
125-127℃ |
| Forráspont |
334.7°C at 760 mmHg |
| Gyulladáspont |
156.2°C |
| Gőznyomás |
0.000126mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
