ChemNet > CAS > 1667-01-2 2',4',6'-Trimethylacetophenone
1667-01-2 2',4',6'-Trimethylacetophenone
| termék neve |
2',4',6'-Trimethylacetophenone |
| Angol név |
2',4',6'-Trimethylacetophenone; 2-Acetylmesitylene; 2,4,6-Trimethylacetophenone; 1-(2,4,6-trimethylphenyl)ethanone |
| MF |
C11H14O |
| Molekulatömeg |
162.2283 |
| InChI |
InChI=1/C11H14O/c1-7-5-8(2)11(10(4)12)9(3)6-7/h5-6H,1-4H3 |
| CAS-szám |
1667-01-2 |
| EINECS |
216-783-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.955g/cm3 |
| Forráspont |
250.2°C at 760 mmHg |
| Törésmutató |
1.509 |
| Gyulladáspont |
99°C |
| Gőznyomás |
0.022mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
