ChemNet > CAS > 16718-12-0 2-(Phenylthio)thiophene
16718-12-0 2-(Phenylthio)thiophene
termék neve |
2-(Phenylthio)thiophene |
Angol név |
2-(Phenylthio)thiophene; Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
MF |
C10H8S2 |
Molekulatömeg |
192.3005 |
InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
CAS-szám |
16718-12-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.24g/cm3 |
Forráspont |
304.7°C at 760 mmHg |
Törésmutató |
1.667 |
Gyulladáspont |
138.1°C |
Gőznyomás |
0.00155mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|