ChemNet > CAS > 17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
termék neve |
4,4'-Dimethoxy-2,2'-bipyridine |
Angol név |
4,4'-Dimethoxy-2,2'-bipyridine; 4,4'-Dimethoxy-[2,2']bipyridinyl |
MF |
C12H12N2O2 |
Molekulatömeg |
216.2359 |
InChI |
InChI=1/C12H12N2O2/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12/h3-8H,1-2H3 |
CAS-szám |
17217-57-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.143g/cm3 |
Olvadáspont |
170-171℃ |
Forráspont |
347.6°C at 760 mmHg |
Törésmutató |
1.551 |
Gyulladáspont |
127°C |
Gőznyomás |
0.000107mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|