ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
| termék neve |
Methyl 2-methoxypropionate |
| Angol név |
Methyl 2-methoxypropionate; 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| MF |
C5H10O3 |
| Molekulatömeg |
118.1311 |
| InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| CAS-szám |
17639-76-8 |
| EINECS |
241-622-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.973g/cm3 |
| Forráspont |
136.2°C at 760 mmHg |
| Törésmutató |
1.389 |
| Gyulladáspont |
40.6°C |
| Gőznyomás |
7.45mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
