ChemNet > CAS > 18066-68-7 Ethyl 3,4-dimethoxyphenylacetate
18066-68-7 Ethyl 3,4-dimethoxyphenylacetate
termék neve |
Ethyl 3,4-dimethoxyphenylacetate |
Angol név |
Ethyl 3,4-dimethoxyphenylacetate; 3,4-Dimethoxyphenylacetic acid ethyl ester |
MF |
C12H16O4 |
Molekulatömeg |
224.253 |
InChI |
InChI=1/C12H16O4/c1-4-16-12(13)8-9-5-6-10(14-2)11(7-9)15-3/h5-7H,4,8H2,1-3H3 |
CAS-szám |
18066-68-7 |
EINECS |
241-974-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.084g/cm3 |
Forráspont |
302°C at 760 mmHg |
Törésmutató |
1.494 |
Gyulladáspont |
129.3°C |
Gőznyomás |
0.00102mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|