18719-43-2 diethyl (3-chloropropyl)malonate

termék neve	diethyl (3-chloropropyl)malonate
Angol név	diethyl (3-chloropropyl)malonate; (3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate
MF	C₁₀H₁₇ClO₄
Molekulatömeg	236.6926
InChI	InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3
CAS-szám	18719-43-2
Molekuláris szerkezete
Sűrűség	1.114g/cm³
Forráspont	290.2°C at 760 mmHg
Törésmutató	1.447
Gyulladáspont	111.9°C
Gőznyomás	0.0021mmHg at 25°C
Veszély szimbólumok
Kockázatot kódok	R36/38:Irritating to eyes and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;