ChemNet > CAS > 18729-48-1 3-Methylcyclopentanol, mixture of isomers
18729-48-1 3-Methylcyclopentanol, mixture of isomers
| termék neve |
3-Methylcyclopentanol, mixture of isomers |
| Angol név |
3-Methylcyclopentanol, mixture of isomers; 1-Methyl-3-cyclopentanol; 3-methylcyclopentanol; (1S,3S)-3-methylcyclopentanol |
| MF |
C6H12O |
| Molekulatömeg |
100.1589 |
| InChI |
InChI=1/C6H12O/c1-5-2-3-6(7)4-5/h5-7H,2-4H2,1H3/t5-,6-/m0/s1 |
| CAS-szám |
18729-48-1 |
| EINECS |
242-540-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.947g/cm3 |
| Forráspont |
146.9°C at 760 mmHg |
| Törésmutató |
1.467 |
| Gyulladáspont |
55°C |
| Gőznyomás |
1.77mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R10:Flammable.;
|
| Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
|
|
