ChemNet > CAS > 1875-89-4 3-Methylphenethyl alcohol
1875-89-4 3-Methylphenethyl alcohol
termék neve |
3-Methylphenethyl alcohol |
Angol név |
3-Methylphenethyl alcohol; 2-m-tolylethanol; 2-(3-Methylphenyl)ethanol; 2-(4-methylphenyl)ethanol; M-METHYL PHENYL ETHANOL; m-Methylphenethyl alcohol |
MF |
C9H12O |
Molekulatömeg |
136.191 |
InChI |
InChI=1/C9H12O/c1-8-2-4-9(5-3-8)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS-szám |
1875-89-4 |
EINECS |
217-508-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.001g/cm3 |
Forráspont |
243.5°C at 760 mmHg |
Törésmutató |
1.532 |
Gyulladáspont |
107.2°C |
Gőznyomás |
0.0172mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|