18937-79-6 Methyl 2-hexynoate
termék neve |
Methyl 2-hexynoate |
Angol név |
Methyl 2-hexynoate; 2-Hexynoic acid methyl ester; methyl hex-2-ynoate |
MF |
C7H10O2 |
Molekulatömeg |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-4H2,1-2H3 |
CAS-szám |
18937-79-6 |
EINECS |
242-690-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.963g/cm3 |
Forráspont |
184.4°C at 760 mmHg |
Törésmutató |
1.436 |
Gyulladáspont |
65.4°C |
Gőznyomás |
0.734mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|