191-07-1 Coronene
termék neve |
Coronene |
Angol név |
Coronene; Hexabenzobenzene; Coronene (purity) |
MF |
C24H12 |
Molekulatömeg |
300.3521 |
InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
CAS-szám |
191-07-1 |
EINECS |
205-881-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.467g/cm3 |
Olvadáspont |
438-440℃ |
Forráspont |
525.6°C at 760 mmHg |
Törésmutató |
2.139 |
Gyulladáspont |
265.2°C |
Gőznyomás |
1.3E-10mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|