ChemNet > CAS > 19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
termék neve |
1-(3,4-Dichlorophenyl)-2-thiourea |
Angol név |
1-(3,4-Dichlorophenyl)-2-thiourea; 3,4-Dichlorophenylthiourea; 1-(3,4-dichlorophenyl)thiourea |
MF |
C7H6Cl2N2S |
Molekulatömeg |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
CAS-szám |
19250-09-0 |
EINECS |
242-919-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.563g/cm3 |
Olvadáspont |
210-213℃ |
Forráspont |
327.7°C at 760 mmHg |
Törésmutató |
1.73 |
Gyulladáspont |
152°C |
Gőznyomás |
0.000198mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|