ChemNet > CAS > 20426-12-4 4-Hydroxychalcone
20426-12-4 4-Hydroxychalcone
| termék neve |
4-Hydroxychalcone |
| Angol név |
4-Hydroxychalcone; 4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| MF |
C15H12O2 |
| Molekulatömeg |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| CAS-szám |
20426-12-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.191g/cm3 |
| Olvadáspont |
183-185℃ |
| Forráspont |
394.9°C at 760 mmHg |
| Törésmutató |
1.653 |
| Gyulladáspont |
168.6°C |
| Gőznyomás |
8.41E-07mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
