ChemNet > CAS > 2096-86-8 4-Methylphenylacetone
2096-86-8 4-Methylphenylacetone
termék neve |
4-Methylphenylacetone |
Angol név |
4-Methylphenylacetone; 1-(4-methylphenyl)propan-2-one |
MF |
C10H12O |
Molekulatömeg |
148.2017 |
InChI |
InChI=1/C10H12O/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6H,7H2,1-2H3 |
CAS-szám |
2096-86-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.974g/cm3 |
Forráspont |
223.1°C at 760 mmHg |
Törésmutató |
1.507 |
Gyulladáspont |
97.1°C |
Gőznyomás |
0.0982mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|