ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
| termék neve |
3-Cyclohexene-1,1-dimethanol |
| Angol név |
3-Cyclohexene-1,1-dimethanol; 4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
| MF |
C8H14O2 |
| Molekulatömeg |
142.1956 |
| InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
| CAS-szám |
2160-94-3 |
| EINECS |
218-481-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.05g/cm3 |
| Olvadáspont |
88-92℃ |
| Forráspont |
231.2°C at 760 mmHg |
| Törésmutató |
1.497 |
| Gyulladáspont |
105°C |
| Gőznyomás |
0.0119mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
