2196-13-6 Thioisonicotinamide
termék neve |
Thioisonicotinamide |
Angol név |
Thioisonicotinamide; isonicotinthioamide; Isothionicotinamide; Pyridine-4-thiocarboxamide; pyridine-4-carbothioamide |
MF |
C6H6N2S |
Molekulatömeg |
138.1902 |
InChI |
InChI=1/C6H6N2S/c7-6(9)5-1-3-8-4-2-5/h1-4H,(H2,7,9) |
CAS-szám |
2196-13-6 |
EINECS |
218-592-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.265g/cm3 |
Olvadáspont |
198-202℃ |
Forráspont |
278.9°C at 760 mmHg |
Törésmutató |
1.664 |
Gyulladáspont |
122.5°C |
Gőznyomás |
0.00415mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|