ChemNet > CAS > 2215-89-6 4,4'-oxybis(benzoic acid)
2215-89-6 4,4'-oxybis(benzoic acid)
termék neve |
4,4'-oxybis(benzoic acid) |
Angol név |
4,4'-oxybis(benzoic acid); 4,4-Dicarboxydiphenyl ether~(Diphenyl ether)-4,4-dicarboxylic acid; 4,4-Diphenyl Ethyl Dicarboxylic Acid; 4,4?Oxybis(benzoic acid); Oxybisbenzoic acid; 4,4'-Oxybisbenzoic acid; 4,4'-Dicarboxydiphenyl ether; Diphenyl ether 4,4'-dicarboxylic acid; 4-(4-carboxyphenoxy)benzoic acid; 4,4'-oxydibenzoic acid; 4,4-Oxybisbenzoic acid; OBBA |
MF |
C14H10O5 |
Molekulatömeg |
258.2262 |
InChI |
InChI=1/C14H10O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16)(H,17,18) |
CAS-szám |
2215-89-6 |
EINECS |
218-683-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.395g/cm3 |
Forráspont |
473.7°C at 760 mmHg |
Törésmutató |
1.638 |
Gyulladáspont |
184.1°C |
Gőznyomás |
8.85E-10mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|