ChemNet > CAS > 22300-56-7 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid
22300-56-7 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid
| termék neve |
4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid |
| Angol név |
4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid; 5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylic acid; 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylate |
| MF |
C10H8N3O2 |
| Molekulatömeg |
202.19 |
| InChI |
InChI=1/C10H9N3O2/c1-7-9(10(14)15)12-13(11-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,14,15)/p-1 |
| CAS-szám |
22300-56-7 |
| Molekuláris szerkezete |
|
| Olvadáspont |
200℃ |
| Forráspont |
432.9°C at 760 mmHg |
| Gyulladáspont |
215.6°C |
| Gőznyomás |
2.91E-08mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
