ChemNet > CAS > 22590-64-3 3-(oxiran-2-ilmetoxi)benzaldehid
22590-64-3 3-(oxiran-2-ilmetoxi)benzaldehid
| termék neve |
3-(oxiran-2-ilmetoxi)benzaldehid |
| Angol név |
3-(oxiran-2-ylmethoxy)benzaldehyde; |
| MF |
C10H10O3 |
| Molekulatömeg |
178.1846 |
| InChI |
InChI=1/C10H10O3/c11-5-8-2-1-3-9(4-8)12-6-10-7-13-10/h1-5,10H,6-7H2 |
| CAS-szám |
22590-64-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.225g/cm3 |
| Forráspont |
318.2°C at 760 mmHg |
| Törésmutató |
1.581 |
| Gyulladáspont |
137.2°C |
| Gőznyomás |
0.000367mmHg at 25°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
