ChemNet > CAS > 22884-95-3 3,4-Dimethylbenzonitrile
22884-95-3 3,4-Dimethylbenzonitrile
termék neve |
3,4-Dimethylbenzonitrile |
Angol név |
3,4-Dimethylbenzonitrile;Benzonitrile, 3,4-dimethyl-; 0-09-00-00536 (Beilstein Handbook Reference); BRN 0970523 |
MF |
C9H9N |
Molekulatömeg |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-3-4-9(6-10)5-8(7)2/h3-5H,1-2H3 |
CAS-szám |
22884-95-3 |
EINECS |
245-293-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.99g/cm3 |
Olvadáspont |
64-66℃ |
Forráspont |
253.5°C at 760 mmHg |
Törésmutató |
1.525 |
Gyulladáspont |
107.1°C |
Gőznyomás |
0.0182mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|