ChemNet > CAS > 23039-94-3 tris(3-fluorophenyl)phosphine
23039-94-3 tris(3-fluorophenyl)phosphine
| termék neve |
tris(3-fluorophenyl)phosphine |
| Angol név |
tris(3-fluorophenyl)phosphine; Tris(3-fluorophenyl)phosphine; tris(3-fluorophenyl)phosphane; Tri(3-fluorophenyl)phosphine |
| MF |
C18H12F3P |
| Molekulatömeg |
316.2569 |
| InChI |
InChI=1/C18H12F3P/c19-13-4-1-7-16(10-13)22(17-8-2-5-14(20)11-17)18-9-3-6-15(21)12-18/h1-12H |
| CAS-szám |
23039-94-3 |
| Molekuláris szerkezete |
|
| Forráspont |
371.1°C at 760 mmHg |
| Gyulladáspont |
178.2°C |
| Gőznyomás |
2.26E-05mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
