ChemNet > CAS > 2362-64-3 4-Methoxythiobenzamide
2362-64-3 4-Methoxythiobenzamide
| termék neve |
4-Methoxythiobenzamide |
| Angol név |
4-Methoxythiobenzamide;Benzenecarbothioamide, 4-methoxy-; Thio-p-anisamide; 4-methoxybenzenecarbothioamide |
| MF |
C8H9NOS |
| Molekulatömeg |
167.2282 |
| InChI |
InChI=1/C8H9NOS/c1-10-7-4-2-6(3-5-7)8(9)11/h2-5H,1H3,(H2,9,11) |
| CAS-szám |
2362-64-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.194g/cm3 |
| Forráspont |
288.5°C at 760 mmHg |
| Törésmutató |
1.619 |
| Gyulladáspont |
128.3°C |
| Gőznyomás |
0.00233mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/22:Harmful by inhalation and if swallowed.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
