2370-61-8 dl-O-tyrosine
termék neve |
dl-O-tyrosine |
Angol név |
dl-O-tyrosine; 3-(2-Hydroxyphenyl)-DL-alanine~H-DL-Phe(2-OH)-OH; 2-hydroxyphenylalanine; 2-amino-3-(1H-indol-3-yl)propan-1-ol ethanedioate (salt) |
MF |
C13H16N2O5 |
Molekulatömeg |
280.2765 |
InChI |
InChI=1/C11H14N2O.C2H2O4/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11;3-1(4)2(5)6/h1-4,6,9,13-14H,5,7,12H2;(H,3,4)(H,5,6) |
CAS-szám |
2370-61-8 |
EINECS |
219-134-8 |
Molekuláris szerkezete |
|
Olvadáspont |
260℃ |
Forráspont |
654.4°C at 760 mmHg |
Gyulladáspont |
349.5°C |
Gőznyomás |
5.14E-18mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|