ChemNet > CAS > 23915-80-2 4-oxo-4H-1-benzopyran-2-carboxylic acid, compound with diethylamine (1:1)
23915-80-2 4-oxo-4H-1-benzopyran-2-carboxylic acid, compound with diethylamine (1:1)
| termék neve |
4-oxo-4H-1-benzopyran-2-carboxylic acid, compound with diethylamine (1:1) |
| Angol név |
4-oxo-4H-1-benzopyran-2-carboxylic acid, compound with diethylamine (1:1);Fludarene; 4-Oxo-4H-1-benzopyran-2-carboxylic acid compd. with N-ethylethanamine (1:1); Angiophtal; Campel; Chromocarb diethylamine; Chromocarbe diethylamine; Diethylamine chromone-carboxylate-2; UNII-R0O8TF63DH; 4-Oxo-4H-1-benzopyran-2-carboxylic acid, compound with diethylamine (1:1); 4H-1-Benzopyran-2-cabroxylic, 4-oxo-, compd. with diethylamine (1:1) (8CI); 4H-1-Benzopyran-2-carboxylic acid, 4-oxo-, compd. with N-ethylethanamine (1:1); 4-oxo-4H-chromene-2-carboxylic acid - N-ethylethanamine (1:1) |
| MF |
C14H17NO4 |
| Molekulatömeg |
263.2891 |
| InChI |
InChI=1/C10H6O4.C4H11N/c11-7-5-9(10(12)13)14-8-4-2-1-3-6(7)8;1-3-5-4-2/h1-5H,(H,12,13);5H,3-4H2,1-2H3 |
| CAS-szám |
23915-80-2 |
| EINECS |
245-939-9 |
| Molekuláris szerkezete |
|
| Forráspont |
337°C at 760 mmHg |
| Gyulladáspont |
138.9°C |
| Gőznyomás |
4.23E-05mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
|
|
