ChemNet > CAS > 2444-37-3 (Methylthio)acetic acid
2444-37-3 (Methylthio)acetic acid
| termék neve |
(Methylthio)acetic acid |
| Angol név |
(Methylthio)acetic acid; NSC 263480; (methylsulfanyl)acetic acid |
| MF |
C3H6O2S |
| Molekulatömeg |
106.1435 |
| InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
| CAS-szám |
2444-37-3 |
| EINECS |
219-483-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.224g/cm3 |
| Olvadáspont |
13-131℃ |
| Forráspont |
225.9°C at 760 mmHg |
| Törésmutató |
1.5 |
| Gyulladáspont |
90.4°C |
| Gőznyomás |
0.0307mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
