ChemNet > CAS > 25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
| termék neve |
1,3-dimethyl-1H-pyrazole-5-carbaldehyde |
| Angol név |
1,3-dimethyl-1H-pyrazole-5-carbaldehyde; 1,3-Dimethylpyrazole-5-carbaldehyde; 2,5-dimethylpyrazole-3-carbaldehyde |
| MF |
C6H8N2O |
| Molekulatömeg |
124.1405 |
| InChI |
InChI=1/C6H8N2O/c1-5-3-6(4-9)8(2)7-5/h3-4H,1-2H3 |
| CAS-szám |
25016-09-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.114g/cm3 |
| Olvadáspont |
40℃ |
| Forráspont |
227.739°C at 760 mmHg |
| Törésmutató |
1.543 |
| Gyulladáspont |
91.534°C |
| Gőznyomás |
0.076mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
