ChemNet > CAS > 25343-30-0 1-(2,6-Diethylphenyl)-thiourea
25343-30-0 1-(2,6-Diethylphenyl)-thiourea
termék neve |
1-(2,6-Diethylphenyl)-thiourea |
Angol név |
1-(2,6-Diethylphenyl)-thiourea; 2,6-Diethylphenylthiourea |
MF |
C11H16N2S |
Molekulatömeg |
208.3231 |
InChI |
InChI=1/C11H16N2S/c1-3-8-6-5-7-9(4-2)10(8)13-11(12)14/h5-7H,3-4H2,1-2H3,(H3,12,13,14) |
CAS-szám |
25343-30-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.137g/cm3 |
Forráspont |
319.3°C at 760 mmHg |
Törésmutató |
1.637 |
Gyulladáspont |
146.9°C |
Gőznyomás |
0.000341mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R25:Toxic if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|