ChemNet > CAS > 27129-87-9 3,5-dimethylbenzyl alcohol
27129-87-9 3,5-dimethylbenzyl alcohol
termék neve |
3,5-dimethylbenzyl alcohol |
Angol név |
3,5-dimethylbenzyl alcohol; 3,5-Dimethylbenzylalcohol; (3,5-dimethylphenyl)methanol |
MF |
C9H12O |
Molekulatömeg |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-3-8(2)5-9(4-7)6-10/h3-5,10H,6H2,1-2H3 |
CAS-szám |
27129-87-9 |
EINECS |
248-241-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.002g/cm3 |
Forráspont |
219.5°C at 760 mmHg |
Törésmutató |
1.536 |
Gyulladáspont |
106.7°C |
Gőznyomás |
0.0689mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|