ChemNet > CAS > 2719-15-5 2-Methyl-4-nitroacetanilide
2719-15-5 2-Methyl-4-nitroacetanilide
| termék neve |
2-Methyl-4-nitroacetanilide |
| Angol név |
2-Methyl-4-nitroacetanilide; N1-(2-Methyl-4-nitrophenyl)acetamide; N-(2-methyl-4-nitrophenyl)acetamide |
| MF |
C9H10N2O3 |
| Molekulatömeg |
194.1873 |
| InChI |
InChI=1/C9H10N2O3/c1-6-5-8(11(13)14)3-4-9(6)10-7(2)12/h3-5H,1-2H3,(H,10,12) |
| CAS-szám |
2719-15-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.289g/cm3 |
| Olvadáspont |
198-200℃ |
| Forráspont |
393.3°C at 760 mmHg |
| Törésmutató |
1.605 |
| Gyulladáspont |
191.7°C |
| Gőznyomás |
2.15E-06mmHg at 25°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
