ChemNet > CAS > 27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
| termék neve |
2,5-Dimethyl-1,3,4-thiadiazole |
| Angol név |
2,5-Dimethyl-1,3,4-thiadiazole;1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
| MF |
C4H6N2S |
| Molekulatömeg |
114.1688 |
| InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
| CAS-szám |
27464-82-0 |
| EINECS |
248-473-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.166g/cm3 |
| Olvadáspont |
62-65℃ |
| Forráspont |
202.5°C at 760 mmHg |
| Törésmutató |
1.534 |
| Gyulladáspont |
81.2°C |
| Gőznyomás |
0.415mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
