ChemNet > CAS > 27738-46-1 3,4-(metiléndioxi)mandelinsav
27738-46-1 3,4-(metiléndioxi)mandelinsav
| termék neve |
3,4-(metiléndioxi)mandelinsav |
| Szinonimák |
alfa-hidroxi-1,3-benzodioxol-5-ecetsav; 1,3-benzodioxol-5-glikolsav; 1,3-benzodioxol-5-il(hidroxi)ecetsav; (2S)-1,3-benzodioxol-5-il(hidroxi)etanoát |
| Angol név |
3,4-(Methylenedioxy)mandelic acid; alpha-Hydroxy-1,3-benzodioxole-5-acetic acid; 1,3-Benzodioxole-5-glycollic acid; 1,3-benzodioxol-5-yl(hydroxy)acetic acid; (2S)-1,3-benzodioxol-5-yl(hydroxy)ethanoate |
| MF |
C9H7O5 |
| Molekulatömeg |
195.1494 |
| InChI |
InChI=1/C9H8O5/c10-8(9(11)12)5-1-2-6-7(3-5)14-4-13-6/h1-3,8,10H,4H2,(H,11,12)/p-1/t8-/m0/s1 |
| CAS-szám |
27738-46-1 |
| EINECS |
248-628-6 |
| Molekuláris szerkezete |
|
| Forráspont |
403.5°C at 760 mmHg |
| Gyulladáspont |
169.2°C |
| Gőznyomás |
3.1E-07mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|