ChemNet > CAS > 2879-42-7 3-Chloro-2,5,6-trifluoropyridine
2879-42-7 3-Chloro-2,5,6-trifluoropyridine
| termék neve |
3-Chloro-2,5,6-trifluoropyridine |
| Angol név |
3-Chloro-2,5,6-trifluoropyridine; |
| MF |
C5HClF3N |
| Molekulatömeg |
167.5163 |
| InChI |
InChI=1/C5HClF3N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| CAS-szám |
2879-42-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.562g/cm3 |
| Forráspont |
151.7°C at 760 mmHg |
| Törésmutató |
1.457 |
| Gyulladáspont |
45.6°C |
| Gőznyomás |
4.62mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
