ChemNet > CAS > 28804-88-8 Dimethylnaphthalene, mixture of isomers
28804-88-8 Dimethylnaphthalene, mixture of isomers
termék neve |
Dimethylnaphthalene, mixture of isomers |
Angol név |
Dimethylnaphthalene, mixture of isomers; naphthalene, 1,2-dimethyl-; 1,2-dimethyl-naphthalene |
MF |
C12H12 |
Molekulatömeg |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
CAS-szám |
28804-88-8 |
EINECS |
249-241-5 |
Molekuláris szerkezete |
|
Sűrűség |
1g/cm3 |
Forráspont |
264.4°C at 760 mmHg |
Törésmutató |
1.604 |
Gyulladáspont |
110.5°C |
Gőznyomás |
0.0159mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|