ChemNet > CAS > 29681-45-6 Methyl 5-methylnicotinate
29681-45-6 Methyl 5-methylnicotinate
| termék neve |
Methyl 5-methylnicotinate |
| Angol név |
Methyl 5-methylnicotinate; Methyl 5-methylpyridine-3-carboxylate; 5-Methylnicotinic acid methyl ester; 5-Methyl-nicotinic acid methyl ester |
| MF |
C8H9NO2 |
| Molekulatömeg |
151.1626 |
| InChI |
InChI=1/C8H9NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h3-5H,1-2H3 |
| CAS-szám |
29681-45-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.104g/cm3 |
| Forráspont |
228.5°C at 760 mmHg |
| Törésmutató |
1.51 |
| Gyulladáspont |
92°C |
| Gőznyomás |
0.0733mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
