ChemNet > CAS > 306934-95-2 5-fenil-2-tienil-bórsav
306934-95-2 5-fenil-2-tienil-bórsav
| termék neve |
5-fenil-2-tienil-bórsav |
| Szinonimák |
;(5-fenil-2-tienil)bórsav; bórsav, B-(5-fenil-2-tienil)-; (5-feniltiofén-2-il)bórsav; 2-fenitiofén-5-ilbórsav |
| Angol név |
5-phenyl-2-thienylboronic acid; (5-Phenyl-2-thienyl)boronic acid; boronic acid, B-(5-phenyl-2-thienyl)-; (5-phenylthiophen-2-yl)boronic acid; 2-phenythiophen-5-ylboronic acid |
| MF |
C10H9BO2S |
| Molekulatömeg |
204.0533 |
| InChI |
InChI=1/C10H9BO2S/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7,12-13H |
| CAS-szám |
306934-95-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.29g/cm3 |
| Olvadáspont |
146℃ |
| Forráspont |
412.9°C at 760 mmHg |
| Törésmutató |
1.632 |
| Gyulladáspont |
203.5°C |
| Gőznyomás |
1.47E-07mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
