ChemNet > CAS > 30711-40-1 2-(n-Heptanoyl)thiophene
30711-40-1 2-(n-Heptanoyl)thiophene
termék neve |
2-(n-Heptanoyl)thiophene |
Angol név |
2-(n-Heptanoyl)thiophene; 1-(2-Thienoyl)hexane; 1-(thiophen-2-yl)heptan-1-one |
MF |
C11H16OS |
Molekulatömeg |
196.3091 |
InChI |
InChI=1/C11H16OS/c1-2-3-4-5-7-10(12)11-8-6-9-13-11/h6,8-9H,2-5,7H2,1H3 |
CAS-szám |
30711-40-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.017g/cm3 |
Forráspont |
295.9°C at 760 mmHg |
Törésmutató |
1.511 |
Gyulladáspont |
132.7°C |
Gőznyomás |
0.00149mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|