3088-42-4 N-(2-Cyanoethyl)glycine
termék neve |
N-(2-Cyanoethyl)glycine |
Angol név |
N-(2-Cyanoethyl)glycine; N-(2-Cyanoehtyl)glycine |
MF |
C5H8N2O2 |
Molekulatömeg |
128.1292 |
InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
CAS-szám |
3088-42-4 |
EINECS |
221-418-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.187g/cm3 |
Olvadáspont |
188-193℃ |
Forráspont |
343.1°C at 760 mmHg |
Törésmutató |
1.473 |
Gyulladáspont |
161.3°C |
Gőznyomás |
1.3E-05mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21:Harmful by inhalation and in contact with skin.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|