ChemNet > CAS > 31805-83-1 1,3-Bis(methylthio)-2-propanol
31805-83-1 1,3-Bis(methylthio)-2-propanol
| termék neve |
1,3-Bis(methylthio)-2-propanol |
| Angol név |
1,3-Bis(methylthio)-2-propanol;1,3-Bis(methylthio)propan-2-ol; 1,3-bis(methylsulfanyl)propan-2-ol |
| MF |
C5H12OS2 |
| Molekulatömeg |
152.2782 |
| InChI |
InChI=1/C5H12OS2/c1-7-3-5(6)4-8-2/h5-6H,3-4H2,1-2H3 |
| CAS-szám |
31805-83-1 |
| EINECS |
250-814-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.112g/cm3 |
| Forráspont |
278.4°C at 760 mmHg |
| Törésmutató |
1.536 |
| Gyulladáspont |
135.8°C |
| Gőznyomás |
0.000523mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
