ChemNet > CAS > 3291-03-0 3,4,5-Trimethoxybenzhydrazide
3291-03-0 3,4,5-Trimethoxybenzhydrazide
termék neve |
3,4,5-Trimethoxybenzhydrazide |
Angol név |
3,4,5-Trimethoxybenzhydrazide;3,4,5-Trimethoxybenzohydrazide |
MF |
C10H14N2O4 |
Molekulatömeg |
226.2292 |
InChI |
InChI=1/C10H14N2O4/c1-14-7-4-6(10(13)12-11)5-8(15-2)9(7)16-3/h4-5H,11H2,1-3H3,(H,12,13) |
CAS-szám |
3291-03-0 |
EINECS |
221-954-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.197g/cm3 |
Törésmutató |
1.534 |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|