ChemNet > CAS > 33524-31-1 2,5-Dimethoxybenzyl alcohol
33524-31-1 2,5-Dimethoxybenzyl alcohol
termék neve |
2,5-Dimethoxybenzyl alcohol |
Angol név |
2,5-Dimethoxybenzyl alcohol;(2,5-dimethoxyphenyl)methanol |
MF |
C9H12O3 |
Molekulatömeg |
168.1898 |
InChI |
InChI=1/C9H12O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-5,10H,6H2,1-2H3 |
CAS-szám |
33524-31-1 |
EINECS |
251-562-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.111g/cm3 |
Forráspont |
305.6°C at 760 mmHg |
Törésmutató |
1.521 |
Gyulladáspont |
127.7°C |
Gőznyomás |
0.000354mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|