ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
termék neve |
Methyl methylsulfinylmethyl sulfide |
Angol név |
Methyl methylsulfinylmethyl sulfide; Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
MF |
C3H8OS2 |
Molekulatömeg |
124.225 |
InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
CAS-szám |
33577-16-1 |
EINECS |
251-577-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.223g/cm3 |
Olvadáspont |
222-226℃ |
Forráspont |
257.772°C at 760 mmHg |
Törésmutató |
1.56 |
Gyulladáspont |
121.4°C |
Gőznyomás |
0.023mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|