33797-51-2 Eschenmoser's salt
termék neve |
Eschenmoser's salt |
Angol név |
Eschenmoser's salt; Dimethyl methyleneammonium iodide; Eschenmosers iodide salt; N,N-Dimethylmethyleneiminium iodide; Eschenmoser salt; N-methyl-N-methylidenemethanaminium iodide |
MF |
C3H8IN |
Molekulatömeg |
185.0068 |
InChI |
InChI=1/C3H8N.HI/c1-4(2)3;/h1H2,2-3H3;1H/q+1;/p-1 |
CAS-szám |
33797-51-2 |
EINECS |
251-680-2 |
Molekuláris szerkezete |
|
Olvadáspont |
219℃ |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|