ChemNet > CAS > 3430-33-9 3-amino-2,6-dimethylpyridine
3430-33-9 3-amino-2,6-dimethylpyridine
| termék neve |
3-amino-2,6-dimethylpyridine |
| Angol név |
3-amino-2,6-dimethylpyridine; 3-Amino-2,6-lutidine; 2,6-dimethylpyridin-3-amine |
| MF |
C7H10N2 |
| Molekulatömeg |
122.1677 |
| InChI |
InChI=1/C7H10N2/c1-5-3-4-7(8)6(2)9-5/h3-4H,8H2,1-2H3 |
| CAS-szám |
3430-33-9 |
| EINECS |
222-332-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.039g/cm3 |
| Forráspont |
231.5°C at 760 mmHg |
| Törésmutató |
1.564 |
| Gyulladáspont |
119.8°C |
| Gőznyomás |
0.0621mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
