ChemNet > CAS > 3481-20-7 2,3,5,6-Tetrachloroaniline
3481-20-7 2,3,5,6-Tetrachloroaniline
termék neve |
2,3,5,6-Tetrachloroaniline |
Angol név |
2,3,5,6-Tetrachloroaniline;NSC 29028; Aniline, 2,3,5,6-tetrachloro- (8CI); Benzenamine, 2,3,5,6-tetrachloro- (9CI) |
MF |
C6H3Cl4N |
Molekulatömeg |
230.9067 |
InChI |
InChI=1/C6H3Cl4N/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,11H2 |
CAS-szám |
3481-20-7 |
EINECS |
222-461-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.655g/cm3 |
Forráspont |
299.1°C at 760 mmHg |
Törésmutató |
1.636 |
Gyulladáspont |
134.7°C |
Gőznyomás |
0.00122mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|