ChemNet > CAS > 34985-37-0 S(-)-2-methyl-1-butylamine
34985-37-0 S(-)-2-methyl-1-butylamine
| termék neve |
S(-)-2-methyl-1-butylamine |
| Angol név |
S(-)-2-methyl-1-butylamine; (S)-(-)-2-Methylbutylamine; (S)-(-)-1-Amino-2-methylbutane; 2-methylbutan-1-amine; (2S)-2-methylbutan-1-amine |
| MF |
C5H13N |
| Molekulatömeg |
87.1634 |
| InChI |
InChI=1/C5H13N/c1-3-5(2)4-6/h5H,3-4,6H2,1-2H3/t5-/m0/s1 |
| CAS-szám |
34985-37-0 |
| EINECS |
252-307-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.757g/cm3 |
| Forráspont |
92.1°C at 760 mmHg |
| Törésmutató |
1.413 |
| Gyulladáspont |
3.3°C |
| Gőznyomás |
52.4mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R11:Highly flammable.;
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
| Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
