ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
termék neve |
di(propylene glycol) butyl ether, mixture of |
Angol név |
di(propylene glycol) butyl ether, mixture of; Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
MF |
C10H22O3 |
Molekulatömeg |
190.2799 |
InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
CAS-szám |
35884-42-5 |
EINECS |
252-776-7 |
Molekuláris szerkezete |
|
Sűrűség |
0.931g/cm3 |
Forráspont |
221.1°C at 760 mmHg |
Törésmutató |
1.435 |
Gyulladáspont |
87.5°C |
Gőznyomás |
0.0226mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
|
|